CAS 444284-83-7 is the registry number for 5-(4-Bromo-2-fluorophenyl)-2-furaldehyde, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(4-bromo-2-fluorophenyl)furan-2-carbaldehyde (CAS 444284-83-7) is a chemical compound with the molecular formula C11H6BrFO2 and a molecular weight of 269.07 g/mol. IUPAC name: 5-(4-bromo-2-fluorophenyl)furan-2-carbaldehyde. InChIKey: IMZTWHIJPAJPQE-UHFFFAOYSA-N.
| Molecular formula | C11H6BrFO2 |
|---|---|
| Molecular weight | 269.07 g/mol |
| IUPAC name | 5-(4-bromo-2-fluorophenyl)furan-2-carbaldehyde |
| InChIKey | IMZTWHIJPAJPQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)