CAS 500365-83-3 is the registry number for 2-Bromo-5-(4-fluorobenzoyl)furan. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(5-bromofuran-2-yl)-(4-fluorophenyl)methanone (CAS 500365-83-3) is a chemical compound with the molecular formula C11H6BrFO2 and a molecular weight of 269.07 g/mol. IUPAC name: (5-bromofuran-2-yl)-(4-fluorophenyl)methanone. InChIKey: ZAQWJESRTXUXBX-UHFFFAOYSA-N.
| Molecular formula | C11H6BrFO2 |
|---|---|
| Molecular weight | 269.07 g/mol |
| IUPAC name | (5-bromofuran-2-yl)-(4-fluorophenyl)methanone |
| InChIKey | ZAQWJESRTXUXBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(O2)Br)F |
Computed by PubChem (NCBI)