Products 944894-44-4
CAS 944894-44-4 is the registry number for 5-(2-Bromo-4-fluorophenyl)furan-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-bromo-4-fluorophenyl)furan-2-carbaldehyde (CAS 944894-44-4) is a chemical compound with the molecular formula C11H6BrFO2 and a molecular weight of 269.07 g/mol. IUPAC name: 5-(2-bromo-4-fluorophenyl)furan-2-carbaldehyde. InChIKey: DBAQZRAOWBTLPO-UHFFFAOYSA-N.
| Molecular formula | C11H6BrFO2 |
|---|---|
| Molecular weight | 269.07 g/mol |
| IUPAC name | 5-(2-bromo-4-fluorophenyl)furan-2-carbaldehyde |
| InChIKey | DBAQZRAOWBTLPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)