CAS 1802225-63-3 is the registry number for (((3,3,3-Trifluoroprop-1-en-1-yl)oxy)methyl)benzene, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[(E)-3,3,3-trifluoroprop-1-enoxy]methylbenzene (CAS 1802225-63-3) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: [(E)-3,3,3-trifluoroprop-1-enoxy]methylbenzene. InChIKey: VQPAEZXUOGRKIL-VOTSOKGWSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | [(E)-3,3,3-trifluoroprop-1-enoxy]methylbenzene |
| InChIKey | VQPAEZXUOGRKIL-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)CO/C=C/C(F)(F)F |
Computed by PubChem (NCBI)