Products 1803262-21-6
CAS 1803262-21-6 is the registry number for Ethyl 4-hydroxy-2,5,6-trimethylpyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2,5,6-trimethyl-4-oxo-1H-pyridine-3-carboxylate (CAS 1803262-21-6) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: ethyl 2,5,6-trimethyl-4-oxo-1H-pyridine-3-carboxylate. InChIKey: KWZFCCHANYEWMZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | ethyl 2,5,6-trimethyl-4-oxo-1H-pyridine-3-carboxylate |
| InChIKey | KWZFCCHANYEWMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1=O)C)C)C |
Computed by PubChem (NCBI)