CAS 1803472-74-3 is the registry number for N-((1S,2S)-2-(Methylamino)-1,2-diphenylethyl)methanesulfonamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
N-[(1S,2S)-2-(methylamino)-1,2-diphenylethyl]methanesulfonamide (CAS 1803472-74-3) is a chemical compound with the molecular formula C16H20N2O2S and a molecular weight of 304.4 g/mol. IUPAC name: N-[(1S,2S)-2-(methylamino)-1,2-diphenylethyl]methanesulfonamide. InChIKey: QCBGDOGGSSKUNG-HOTGVXAUSA-N.
| Molecular formula | C16H20N2O2S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | N-[(1S,2S)-2-(methylamino)-1,2-diphenylethyl]methanesulfonamide |
| InChIKey | QCBGDOGGSSKUNG-HOTGVXAUSA-N |
| SMILES | CN[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)NS(=O)(=O)C |
Computed by PubChem (NCBI)