CAS 438003-27-1 is the registry number for 4-Amino-N-(4-butylphenyl)benzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-N-(4-butylphenyl)benzenesulfonamide (CAS 438003-27-1) is a chemical compound with the molecular formula C16H20N2O2S and a molecular weight of 304.4 g/mol. IUPAC name: 4-amino-N-(4-butylphenyl)benzenesulfonamide. InChIKey: FJLPOHYIDNZJOA-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O2S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 4-amino-N-(4-butylphenyl)benzenesulfonamide |
| InChIKey | FJLPOHYIDNZJOA-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)