Products 208336-29-2
CAS 208336-29-2 is the registry number for D-(+)-Carvone Tosylhydrazone. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
4-methyl-N-[(E)-[(5S)-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]benzenesulfonamide (CAS 208336-29-2) is a chemical compound with the molecular formula C16H20N2O2S and a molecular weight of 304.4 g/mol. IUPAC name: 4-methyl-N-[(E)-[(5S)-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]benzenesulfonamide. InChIKey: MDUMZGRBXYGQRJ-MBUFOBGISA-N.
| Molecular formula | C16H20N2O2S |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 4-methyl-N-[(E)-[(5S)-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]benzenesulfonamide |
| InChIKey | MDUMZGRBXYGQRJ-MBUFOBGISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/2\C[C@H](CC=C2)C(=C)C |
Computed by PubChem (NCBI)
Synonyms:
D-(+)-Carvone Tosylhydrazone