Products 330955-59-4

CAS 330955-59-4 is the registry number for 3-((1-Cyclohexyl-1H-benzo[d]imidazol-2-yl)thio)propanoic acid, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

3-(1-cyclohexylbenzimidazol-2-yl)sulfanylpropanoic acid (CAS 330955-59-4) is a chemical compound with the molecular formula C16H20N2O2S and a molecular weight of 304.4 g/mol. IUPAC name: 3-(1-cyclohexylbenzimidazol-2-yl)sulfanylpropanoic acid. InChIKey: QPHBYFQFLMXRFV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20N2O2S
Molecular weight304.4 g/mol
IUPAC name3-(1-cyclohexylbenzimidazol-2-yl)sulfanylpropanoic acid
InChIKeyQPHBYFQFLMXRFV-UHFFFAOYSA-N
SMILESC1CCC(CC1)N2C3=CC=CC=C3N=C2SCCC(=O)O

Computed by PubChem (NCBI)