CAS 1803582-66-2 appears in our catalog under these names: tert-Butyl 7-amino-2,3,4,5-tetrahydro-1,4-benzoxazepine-4-carboxylate hydrochloride, 95%, tert-Butyl 7-amino-2,3,4,5-tetrahydro-1,4-benzoxazepine-4-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Tert-butyl 7-amino-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate;hydrochloride (CAS 1803582-66-2) is a chemical compound with the molecular formula C14H21ClN2O3 and a molecular weight of 300.78 g/mol. IUPAC name: tert-butyl 7-amino-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate;hydrochloride. InChIKey: WZUWYBWITWPERT-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN2O3 |
|---|---|
| Molecular weight | 300.78 g/mol |
| IUPAC name | tert-butyl 7-amino-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate;hydrochloride |
| InChIKey | WZUWYBWITWPERT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=C(C=C2)N.Cl |
Computed by PubChem (NCBI)