CAS 2173637-15-3 appears in our catalog under these names: Trans-1-cbz-4-amino-3-methoxypiperidine hydrochloride, 95%, Benzyl (3S,4S)-4-amino-3-methoxypiperidine-1-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, on request.
Benzyl (3S,4S)-4-amino-3-methoxypiperidine-1-carboxylate;hydrochloride (CAS 2173637-15-3) is a chemical compound with the molecular formula C14H21ClN2O3 and a molecular weight of 300.78 g/mol. IUPAC name: benzyl (3S,4S)-4-amino-3-methoxypiperidine-1-carboxylate;hydrochloride. InChIKey: HBTOPFVAMPQCDT-QNTKWALQSA-N.
| Molecular formula | C14H21ClN2O3 |
|---|---|
| Molecular weight | 300.78 g/mol |
| IUPAC name | benzyl (3S,4S)-4-amino-3-methoxypiperidine-1-carboxylate;hydrochloride |
| InChIKey | HBTOPFVAMPQCDT-QNTKWALQSA-N |
| SMILES | CO[C@H]1CN(CC[C@@H]1N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)