Products 66532-86-3
CAS 66532-86-3 appears in our catalog under these names: Propacetamol hydrochloride, 95%, Propacetamol Hydrochloride, >95% (HPLC), Propacetamol Hydrochloride/ 100%, Propacetamol hydrochloride, N,N-Diethylglycine 4-(acetylamino)phenyl ester hydrochloride, 99%, 99%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 50mg, 200mg, 25mg.
(4-acetamidophenyl) 2-(diethylamino)acetate;hydrochloride (CAS 66532-86-3) is a chemical compound with the molecular formula C14H21ClN2O3 and a molecular weight of 300.78 g/mol. IUPAC name: (4-acetamidophenyl) 2-(diethylamino)acetate;hydrochloride. InChIKey: WGTYJNGARJPYKG-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN2O3 |
|---|---|
| Molecular weight | 300.78 g/mol |
| IUPAC name | (4-acetamidophenyl) 2-(diethylamino)acetate;hydrochloride |
| InChIKey | WGTYJNGARJPYKG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)OC1=CC=C(C=C1)NC(=O)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
Propacetamol hydrochloride, Pro-efferalgan, Pro-Dafalgan, Glycine, N,N-diethyl-, 4-(acetylamino)phenyl ester, monohydrochloride, Propacetamol HCL, 4-Acetamidophenyl 2-(diethylamino)acetate hydrochloride, (4-acetamidophenyl) 2-(diethylamino)acetate hydrochloride, Propacetamol (hydrochloride), Pro-efferalgan; UP 34101, N,N-diethylglycine 4-(acetylamino)phenyl ester hydrochloride