Products 573704-40-2

CAS 573704-40-2 is the registry number for Melphalan EP Impurity I. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-amino-3-[4-[2-chloroethyl(2-methoxyethyl)amino]phenyl]propanoic acid (CAS 573704-40-2) is a chemical compound with the molecular formula C14H21ClN2O3 and a molecular weight of 300.78 g/mol. IUPAC name: (2S)-2-amino-3-[4-[2-chloroethyl(2-methoxyethyl)amino]phenyl]propanoic acid. InChIKey: GWIGVGLQCQAQHP-ZDUSSCGKSA-N.

Identity
Molecular formulaC14H21ClN2O3
Molecular weight300.78 g/mol
IUPAC name(2S)-2-amino-3-[4-[2-chloroethyl(2-methoxyethyl)amino]phenyl]propanoic acid
InChIKeyGWIGVGLQCQAQHP-ZDUSSCGKSA-N
SMILESCOCCN(CCCl)C1=CC=C(C=C1)C[C@@H](C(=O)O)N

Computed by PubChem (NCBI)