CAS 1803584-63-5 appears in our catalog under these names: 1-(2-Amino-2-phenylethyl)-1,2-dihydropyridin-2-one hydrochloride, 95%, 1-(2-Amino-2-phenylethyl)-1,2-dihydropyridin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2-amino-2-phenylethyl)pyridin-2-one;hydrochloride (CAS 1803584-63-5) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: 1-(2-amino-2-phenylethyl)pyridin-2-one;hydrochloride. InChIKey: HIVDXLCLDDKTOI-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | 1-(2-amino-2-phenylethyl)pyridin-2-one;hydrochloride |
| InChIKey | HIVDXLCLDDKTOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN2C=CC=CC2=O)N.Cl |
Computed by PubChem (NCBI)