Products 1803584-75-9
CAS 1803584-75-9 appears in our catalog under these names: 6-Methanesulfonylpyrazine-2-carboxylic acid, 98%, 6-Methanesulfonylpyrazine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.
6-methylsulfonylpyrazine-2-carboxylic acid (CAS 1803584-75-9) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 6-methylsulfonylpyrazine-2-carboxylic acid. InChIKey: MIDCPVOPLSZIGB-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 6-methylsulfonylpyrazine-2-carboxylic acid |
| InChIKey | MIDCPVOPLSZIGB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC(=CN=C1)C(=O)O |
Computed by PubChem (NCBI)