Products 1803585-36-5
CAS 1803585-36-5 is the registry number for 1-{5,7-Dimethyl-4H,7H-(1,2,3,4)tetrazolo(1,5-a)pyrimidin-6-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-6-yl)ethanone (CAS 1803585-36-5) is a chemical compound with the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. IUPAC name: 1-(5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-6-yl)ethanone. InChIKey: QVJRWPYRFBQJNQ-UHFFFAOYSA-N.
| Molecular formula | C8H11N5O |
|---|---|
| Molecular weight | 193.21 g/mol |
| IUPAC name | 1-(5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidin-6-yl)ethanone |
| InChIKey | QVJRWPYRFBQJNQ-UHFFFAOYSA-N |
| SMILES | CC1C(=C(NC2=NN=NN12)C)C(=O)C |
Computed by PubChem (NCBI)