CAS 1803585-78-5 appears in our catalog under these names: tert-Butyl N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)carbamate, 95%, tert-Butyl N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)carbamate (CAS 1803585-78-5) is a chemical compound with the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. IUPAC name: tert-butyl N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)carbamate. InChIKey: NXORJPOEGFGNGQ-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | tert-butyl N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)carbamate |
| InChIKey | NXORJPOEGFGNGQ-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=C(S1)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)