Products 1803589-24-3
CAS 1803589-24-3 is the registry number for 3-(2-{((tert-Butoxy)carbonyl)amino}propan-2-yl)-1,2-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]-1,2-oxazole-4-carboxylic acid (CAS 1803589-24-3) is a chemical compound with the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]-1,2-oxazole-4-carboxylic acid. InChIKey: RDNQFBQCQXOTQO-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O5 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]-1,2-oxazole-4-carboxylic acid |
| InChIKey | RDNQFBQCQXOTQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C1=NOC=C1C(=O)O |
Computed by PubChem (NCBI)