CAS 1803590-79-5 appears in our catalog under these names: 5'-Bromo-1',2'-dihydrospiro(cyclobutane-1,3'-indole) hydrochloride, 95%, 5'-Bromo-1',2'-dihydrospiro(cyclobutane-1,3'-indole) hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromospiro[1,2-dihydroindole-3,1'-cyclobutane];hydrochloride (CAS 1803590-79-5) is a chemical compound with the molecular formula C11H13BrClN and a molecular weight of 274.58 g/mol. IUPAC name: 5-bromospiro[1,2-dihydroindole-3,1'-cyclobutane];hydrochloride. InChIKey: XVVUFFDLUHTXMH-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClN |
|---|---|
| Molecular weight | 274.58 g/mol |
| IUPAC name | 5-bromospiro[1,2-dihydroindole-3,1'-cyclobutane];hydrochloride |
| InChIKey | XVVUFFDLUHTXMH-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNC3=C2C=C(C=C3)Br.Cl |
Computed by PubChem (NCBI)