CAS 1803591-94-7 appears in our catalog under these names: 4-(3-Aminophenyl)-1,2,4-triazolidine-3,5-dione hydrochloride, 95%, 4-(3-Aminophenyl)-1,2,4-triazolidine-3,5-dione hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(3-aminophenyl)-1,2,4-triazolidine-3,5-dione;hydrochloride (CAS 1803591-94-7) is a chemical compound with the molecular formula C8H9ClN4O2 and a molecular weight of 228.63 g/mol. IUPAC name: 4-(3-aminophenyl)-1,2,4-triazolidine-3,5-dione;hydrochloride. InChIKey: OWPWKWMYZDKSPV-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4O2 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 4-(3-aminophenyl)-1,2,4-triazolidine-3,5-dione;hydrochloride |
| InChIKey | OWPWKWMYZDKSPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=O)NNC2=O)N.Cl |
Computed by PubChem (NCBI)