Products 1803592-88-2
CAS 1803592-88-2 is the registry number for 7-Fluoro-1,2,3,4-tetrahydroquinolin-4-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-fluoro-1,2,3,4-tetrahydroquinolin-4-amine;dihydrochloride (CAS 1803592-88-2) is a chemical compound with the molecular formula C9H13Cl2FN2 and a molecular weight of 239.11 g/mol. IUPAC name: 7-fluoro-1,2,3,4-tetrahydroquinolin-4-amine;dihydrochloride. InChIKey: KBTFLVMKVWWHBF-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2FN2 |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 7-fluoro-1,2,3,4-tetrahydroquinolin-4-amine;dihydrochloride |
| InChIKey | KBTFLVMKVWWHBF-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1N)C=CC(=C2)F.Cl.Cl |
Computed by PubChem (NCBI)