Products 1803596-30-6
CAS 1803596-30-6 is the registry number for 1-((2-Bromophenyl)methyl)cyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(2-bromophenyl)methyl]cyclopropan-1-amine;hydrochloride (CAS 1803596-30-6) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 1-[(2-bromophenyl)methyl]cyclopropan-1-amine;hydrochloride. InChIKey: JTBCZUFGFUMMLY-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 1-[(2-bromophenyl)methyl]cyclopropan-1-amine;hydrochloride |
| InChIKey | JTBCZUFGFUMMLY-UHFFFAOYSA-N |
| SMILES | C1CC1(CC2=CC=CC=C2Br)N.Cl |
Computed by PubChem (NCBI)