Products 1803598-33-5
CAS 1803598-33-5 is the registry number for Cyclobutyl(3-(trifluoromethyl)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cyclobutyl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 1803598-33-5) is a chemical compound with the molecular formula C12H15ClF3N and a molecular weight of 265.70 g/mol. IUPAC name: cyclobutyl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: IXYBCGMWYAXCSG-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N |
|---|---|
| Molecular weight | 265.70 g/mol |
| IUPAC name | cyclobutyl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | IXYBCGMWYAXCSG-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(C2=CC(=CC=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)