Products 1803598-48-2

CAS 1803598-48-2 is the registry number for 3-(4-Methyl-6-oxo-1,6-dihydropyrimidin-1-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

3-(4-methyl-6-oxopyrimidin-1-yl)propanoic acid;hydrochloride (CAS 1803598-48-2) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 3-(4-methyl-6-oxopyrimidin-1-yl)propanoic acid;hydrochloride. InChIKey: NQOPEJBURKDSPT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClN2O3
Molecular weight218.64 g/mol
IUPAC name3-(4-methyl-6-oxopyrimidin-1-yl)propanoic acid;hydrochloride
InChIKeyNQOPEJBURKDSPT-UHFFFAOYSA-N
SMILESCC1=CC(=O)N(C=N1)CCC(=O)O.Cl

Computed by PubChem (NCBI)