CAS 1803598-57-3 appears in our catalog under these names: N,4-Dimethoxy-n,2-dimethylbenzamide, 95%, N,4-Dimethoxy-N,2-dimethylbenzamide, N,4-Dimethoxy-N,2-dimethylbenzamide 95%, N,4-Dimethoxy-N,2-dimethylbenzamide, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 0,5g, 100mg, 250mg.
N,4-dimethoxy-N,2-dimethylbenzamide (CAS 1803598-57-3) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: N,4-dimethoxy-N,2-dimethylbenzamide. InChIKey: LGXNGQKXOAFEKZ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | N,4-dimethoxy-N,2-dimethylbenzamide |
| InChIKey | LGXNGQKXOAFEKZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)C(=O)N(C)OC |
Computed by PubChem (NCBI)