CAS 1803600-25-0 is the registry number for {3-Methyl-3H-imidazo(4,5-c)pyridin-2-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3-methylimidazo[4,5-c]pyridin-2-yl)methanamine;dihydrochloride (CAS 1803600-25-0) is a chemical compound with the molecular formula C8H12Cl2N4 and a molecular weight of 235.11 g/mol. IUPAC name: (3-methylimidazo[4,5-c]pyridin-2-yl)methanamine;dihydrochloride. InChIKey: KWAPBEQUAPMRDK-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N4 |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | (3-methylimidazo[4,5-c]pyridin-2-yl)methanamine;dihydrochloride |
| InChIKey | KWAPBEQUAPMRDK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CN=C2)N=C1CN.Cl.Cl |
Computed by PubChem (NCBI)