Products 1803601-62-8
CAS 1803601-62-8 is the registry number for 1-((1-Amino-2-methylpropan-2-yl)oxy)-3,5-difluorobenzene hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,5-difluorophenoxy)-2-methylpropan-1-amine;hydrochloride (CAS 1803601-62-8) is a chemical compound with the molecular formula C10H14ClF2NO and a molecular weight of 237.67 g/mol. IUPAC name: 2-(3,5-difluorophenoxy)-2-methylpropan-1-amine;hydrochloride. InChIKey: AWEXDKXLAOZTAZ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClF2NO |
|---|---|
| Molecular weight | 237.67 g/mol |
| IUPAC name | 2-(3,5-difluorophenoxy)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | AWEXDKXLAOZTAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)OC1=CC(=CC(=C1)F)F.Cl |
Computed by PubChem (NCBI)