Products 2411177-24-5
CAS 2411177-24-5 is the registry number for (1R)-1-(4-(2,2-Difluoroethoxy)phenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R)-1-[4-(2,2-difluoroethoxy)phenyl]ethanamine;hydrochloride (CAS 2411177-24-5) is a chemical compound with the molecular formula C10H14ClF2NO and a molecular weight of 237.67 g/mol. IUPAC name: (1R)-1-[4-(2,2-difluoroethoxy)phenyl]ethanamine;hydrochloride. InChIKey: RPFMNROZVAKGHC-OGFXRTJISA-N.
| Molecular formula | C10H14ClF2NO |
|---|---|
| Molecular weight | 237.67 g/mol |
| IUPAC name | (1R)-1-[4-(2,2-difluoroethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | RPFMNROZVAKGHC-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)OCC(F)F)N.Cl |
Computed by PubChem (NCBI)