CAS 2873558-72-4 is the registry number for (S)-3-(Benzyloxy)-1,1-difluoropropan-2-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1,1-difluoro-3-phenylmethoxypropan-2-amine;hydrochloride (CAS 2873558-72-4) is a chemical compound with the molecular formula C10H14ClF2NO and a molecular weight of 237.67 g/mol. IUPAC name: (2S)-1,1-difluoro-3-phenylmethoxypropan-2-amine;hydrochloride. InChIKey: KZDDUXKLQPGQEZ-FVGYRXGTSA-N.
| Molecular formula | C10H14ClF2NO |
|---|---|
| Molecular weight | 237.67 g/mol |
| IUPAC name | (2S)-1,1-difluoro-3-phenylmethoxypropan-2-amine;hydrochloride |
| InChIKey | KZDDUXKLQPGQEZ-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H](C(F)F)N.Cl |
Computed by PubChem (NCBI)