Products 2377035-54-4
CAS 2377035-54-4 is the registry number for 2,2-Difluoro-2-(3-methoxy-4-methylphenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2-difluoro-2-(3-methoxy-4-methylphenyl)ethanamine;hydrochloride (CAS 2377035-54-4) is a chemical compound with the molecular formula C10H14ClF2NO and a molecular weight of 237.67 g/mol. IUPAC name: 2,2-difluoro-2-(3-methoxy-4-methylphenyl)ethanamine;hydrochloride. InChIKey: QZHODOUGWXHXDT-UHFFFAOYSA-N.
| Molecular formula | C10H14ClF2NO |
|---|---|
| Molecular weight | 237.67 g/mol |
| IUPAC name | 2,2-difluoro-2-(3-methoxy-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | QZHODOUGWXHXDT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(CN)(F)F)OC.Cl |
Computed by PubChem (NCBI)