CAS 1803607-13-7 appears in our catalog under these names: 7,8-Dichloro-3,4-dihydro-2h-1-benzopyran-4-amine hydrochloride, 95%, 7,8-Dichloro-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1803607-13-7) is a chemical compound with the molecular formula C9H10Cl3NO and a molecular weight of 254.5 g/mol. IUPAC name: 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: VYJZOAGPDFHSJL-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 7,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | VYJZOAGPDFHSJL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC(=C2Cl)Cl.Cl |
Computed by PubChem (NCBI)