CAS 606129-60-6 appears in our catalog under these names: 3-(3,4-Dichlorophenoxy)azetidine hydrochloride, 98+%, 3-(3,4-Dichlorophenoxy)azetidine hydrochloride, 95%, 95%, 3-(3,4-Dichlorophenoxy)azetidine hydrochloride, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g.
3-(3,4-dichlorophenoxy)azetidine;hydrochloride (CAS 606129-60-6) is a chemical compound with the molecular formula C9H10Cl3NO and a molecular weight of 254.5 g/mol. IUPAC name: 3-(3,4-dichlorophenoxy)azetidine;hydrochloride. InChIKey: WCGIRDBDXDCUDD-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 3-(3,4-dichlorophenoxy)azetidine;hydrochloride |
| InChIKey | WCGIRDBDXDCUDD-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)