Products 2408963-21-1
CAS 2408963-21-1 is the registry number for 6,8-Dichlorochroman-4-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2408963-21-1) is a chemical compound with the molecular formula C9H10Cl3NO and a molecular weight of 254.5 g/mol. IUPAC name: 6,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: DMUPRINIJPDGQI-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 6,8-dichloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | DMUPRINIJPDGQI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=C(C=C2Cl)Cl.Cl |
Computed by PubChem (NCBI)