CAS 948595-84-4 appears in our catalog under these names: 3-Amino-1-(2,4-dichlorophenyl)propan-1-one hydrochloride, 95%, 3-Amino-1-(2,4-dichlorophenyl)propan-1-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-1-(2,4-dichlorophenyl)propan-1-one;hydrochloride (CAS 948595-84-4) is a chemical compound with the molecular formula C9H10Cl3NO and a molecular weight of 254.5 g/mol. IUPAC name: 3-amino-1-(2,4-dichlorophenyl)propan-1-one;hydrochloride. InChIKey: KLJYQKNZPDMABP-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3NO |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 3-amino-1-(2,4-dichlorophenyl)propan-1-one;hydrochloride |
| InChIKey | KLJYQKNZPDMABP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)CCN.Cl |
Computed by PubChem (NCBI)