Products 1803608-00-5
CAS 1803608-00-5 appears in our catalog under these names: Ethyl 2–{3–azaspiro(5·5)undecan–9–yl}acetate hydrochloride, ethyl 2-{3-azaspiro[5.5]undecan-9-yl}acetate hydrochloride, 95%, Ethyl 2-{3-azaspiro(5.5)undecan-9-yl}acetate hydrochloride, ETHYL 2-(3-AZASPIRO[5.5]UNDECAN-9-YL)ACETATE HYDROCHLORIDE, 95%, 95%, ETHYL 2-(3-AZASPIRO[5.5]UNDECAN-9-YL)ACETATE HYDROCHLORIDE, 95%. Offered by: GLPBio, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 0,5g, 50mg.
Ethyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate;hydrochloride (CAS 1803608-00-5) is a chemical compound with the molecular formula C14H26ClNO2 and a molecular weight of 275.81 g/mol. IUPAC name: ethyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate;hydrochloride. InChIKey: QRFATOAMIXVMSA-UHFFFAOYSA-N.
| Molecular formula | C14H26ClNO2 |
|---|---|
| Molecular weight | 275.81 g/mol |
| IUPAC name | ethyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate;hydrochloride |
| InChIKey | QRFATOAMIXVMSA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCC2(CC1)CCNCC2.Cl |
Computed by PubChem (NCBI)