Products 2375268-97-4

CAS 2375268-97-4 is the registry number for Ethyl 2-(piperidin-4-yl)cyclohexane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-piperidin-4-ylcyclohexane-1-carboxylate;hydrochloride (CAS 2375268-97-4) is a chemical compound with the molecular formula C14H26ClNO2 and a molecular weight of 275.81 g/mol. IUPAC name: ethyl 2-piperidin-4-ylcyclohexane-1-carboxylate;hydrochloride. InChIKey: PXFNIPOAWJGIMO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26ClNO2
Molecular weight275.81 g/mol
IUPAC nameethyl 2-piperidin-4-ylcyclohexane-1-carboxylate;hydrochloride
InChIKeyPXFNIPOAWJGIMO-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCCCC1C2CCNCC2.Cl

Computed by PubChem (NCBI)