CAS 2219407-57-3 is the registry number for tert-Butyl 2-amino-7,7-dimethylbicyclo(2.2.1)heptane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate;hydrochloride (CAS 2219407-57-3) is a chemical compound with the molecular formula C14H26ClNO2 and a molecular weight of 275.81 g/mol. IUPAC name: tert-butyl 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate;hydrochloride. InChIKey: WSLSWNBCKPEIBG-UHFFFAOYSA-N.
| Molecular formula | C14H26ClNO2 |
|---|---|
| Molecular weight | 275.81 g/mol |
| IUPAC name | tert-butyl 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate;hydrochloride |
| InChIKey | WSLSWNBCKPEIBG-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(C2)N)C(=O)OC(C)(C)C)C.Cl |
Computed by PubChem (NCBI)