Products 1834470-91-5

CAS 1834470-91-5 is the registry number for 5-(2-Cyclopentylpyrrolidin-1-yl)pentanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(2-cyclopentylpyrrolidin-1-yl)pentanoic acid;hydrochloride (CAS 1834470-91-5) is a chemical compound with the molecular formula C14H26ClNO2 and a molecular weight of 275.81 g/mol. IUPAC name: 5-(2-cyclopentylpyrrolidin-1-yl)pentanoic acid;hydrochloride. InChIKey: OXSCVZIKLSZFLF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26ClNO2
Molecular weight275.81 g/mol
IUPAC name5-(2-cyclopentylpyrrolidin-1-yl)pentanoic acid;hydrochloride
InChIKeyOXSCVZIKLSZFLF-UHFFFAOYSA-N
SMILESC1CCC(C1)C2CCCN2CCCCC(=O)O.Cl

Computed by PubChem (NCBI)