CAS 1803608-26-5 appears in our catalog under these names: 1-(1-Benzyl-2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoroethan-1-one, 95%, 1-(1-Benzyl-2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2,2,2-trifluoroethanone (CAS 1803608-26-5) is a chemical compound with the molecular formula C15H14F3NO and a molecular weight of 281.27 g/mol. IUPAC name: 1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2,2,2-trifluoroethanone. InChIKey: QNSIRAJXGSFGNF-UHFFFAOYSA-N.
| Molecular formula | C15H14F3NO |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2,2,2-trifluoroethanone |
| InChIKey | QNSIRAJXGSFGNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC2=CC=CC=C2)C)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)