CAS 2270909-41-4 is the registry number for C-[3'-(2,2,2-Trifluoro-ethoxy)-biphenyl-4-yl]-methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-[3-(2,2,2-trifluoroethoxy)phenyl]phenyl]methanamine (CAS 2270909-41-4) is a chemical compound with the molecular formula C15H14F3NO and a molecular weight of 281.27 g/mol. IUPAC name: [4-[3-(2,2,2-trifluoroethoxy)phenyl]phenyl]methanamine. InChIKey: JFLRKFWWHJOXLB-UHFFFAOYSA-N.
| Molecular formula | C15H14F3NO |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | [4-[3-(2,2,2-trifluoroethoxy)phenyl]phenyl]methanamine |
| InChIKey | JFLRKFWWHJOXLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)