CAS 3032196-65-6 is the registry number for TEAD-IN-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]azetidin-1-yl]prop-2-en-1-one (CAS 3032196-65-6) is a chemical compound with the molecular formula C15H14F3NO and a molecular weight of 281.27 g/mol. IUPAC name: 1-[3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]azetidin-1-yl]prop-2-en-1-one. InChIKey: AEOJURJVNCDASZ-ONEGZZNKSA-N.
| Molecular formula | C15H14F3NO |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 1-[3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]azetidin-1-yl]prop-2-en-1-one |
| InChIKey | AEOJURJVNCDASZ-ONEGZZNKSA-N |
| SMILES | C=CC(=O)N1CC(C1)/C=C/C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)