Products 619319-92-5

CAS 619319-92-5 is the registry number for N-(p-Methoxybenzyl)-3-trifluoromethyl aniline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

N-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)aniline (CAS 619319-92-5) is a chemical compound with the molecular formula C15H14F3NO and a molecular weight of 281.27 g/mol. IUPAC name: N-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)aniline. InChIKey: ZPTBQKJOHBCVON-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14F3NO
Molecular weight281.27 g/mol
IUPAC nameN-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)aniline
InChIKeyZPTBQKJOHBCVON-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CNC2=CC=CC(=C2)C(F)(F)F

Computed by PubChem (NCBI)