CAS 1803609-18-8 appears in our catalog under these names: 2-(Thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%, 2-(Thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1803609-18-8) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: 2-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: WSTYNPDBAZHCMT-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | 2-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | WSTYNPDBAZHCMT-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)(CC2=CC=CS2)C(=O)O.Cl |
Computed by PubChem (NCBI)