CAS 1312206-52-2 is the registry number for 3-Chloro-n,n-diethylbenzene-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N,N-diethylbenzenesulfonamide (CAS 1312206-52-2) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: 3-chloro-N,N-diethylbenzenesulfonamide. InChIKey: VYJSTFSBUJVKFF-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | 3-chloro-N,N-diethylbenzenesulfonamide |
| InChIKey | VYJSTFSBUJVKFF-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)