CAS 1003562-01-3 appears in our catalog under these names: 3-(Phenylsulfonyl)pyrrolidine, 95%, 3-(Benzenesulfonyl)pyrrolidine hydrochloride, 95%, 3-(Phenylsulfonyl)pyrrolidine hydrochloride, 97%, 3-(Phenylsulfonyl)pyrrolidine hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 500mg.
3-(benzenesulfonyl)pyrrolidine;hydrochloride (CAS 1003562-01-3) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: 3-(benzenesulfonyl)pyrrolidine;hydrochloride. InChIKey: MUMXFWPSGKJXFA-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | 3-(benzenesulfonyl)pyrrolidine;hydrochloride |
| InChIKey | MUMXFWPSGKJXFA-UHFFFAOYSA-N |
| SMILES | C1CNCC1S(=O)(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)