CAS 1049753-34-5 appears in our catalog under these names: (2S,4S)-4-(Thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%, (2S,4S)-4-(Thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(2S,4S)-4-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049753-34-5) is a chemical compound with the molecular formula C10H14ClNO2S and a molecular weight of 247.74 g/mol. IUPAC name: (2S,4S)-4-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: KHRZNWRJSUYQPW-JXLXBRSFSA-N.
| Molecular formula | C10H14ClNO2S |
|---|---|
| Molecular weight | 247.74 g/mol |
| IUPAC name | (2S,4S)-4-(thiophen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | KHRZNWRJSUYQPW-JXLXBRSFSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC=CS2.Cl |
Computed by PubChem (NCBI)