Products 1803819-36-4
CAS 1803819-36-4 appears in our catalog under these names: 2-(2,3-Dichloro-4-fluorophenyl)acetic acid, 95%, 2-(2,3-Dichloro-4-fluorophenyl)acetic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-(2,3-dichloro-4-fluorophenyl)acetic acid (CAS 1803819-36-4) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 2-(2,3-dichloro-4-fluorophenyl)acetic acid. InChIKey: ATOGPFGVSSBPRS-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 2-(2,3-dichloro-4-fluorophenyl)acetic acid |
| InChIKey | ATOGPFGVSSBPRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(=O)O)Cl)Cl)F |
Computed by PubChem (NCBI)