CAS 1804382-46-4 is the registry number for 6-Bromo-3-chloro-2-fluorophenacyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-(6-bromo-3-chloro-2-fluorophenyl)ethanone (CAS 1804382-46-4) is a chemical compound with the molecular formula C8H4Br2ClFO and a molecular weight of 330.37 g/mol. IUPAC name: 2-bromo-1-(6-bromo-3-chloro-2-fluorophenyl)ethanone. InChIKey: VIQIMEJKLUENCG-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2ClFO |
|---|---|
| Molecular weight | 330.37 g/mol |
| IUPAC name | 2-bromo-1-(6-bromo-3-chloro-2-fluorophenyl)ethanone |
| InChIKey | VIQIMEJKLUENCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)F)C(=O)CBr)Br |
Computed by PubChem (NCBI)