CAS 1805575-98-7 appears in our catalog under these names: 2-Bromo-1-(3-bromo-2-chloro-6-fluorophenyl)ethanone, 95%, 3-Bromo-2-chloro-6-fluorophenacyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-1-(3-bromo-2-chloro-6-fluorophenyl)ethanone (CAS 1805575-98-7) is a chemical compound with the molecular formula C8H4Br2ClFO and a molecular weight of 330.37 g/mol. IUPAC name: 2-bromo-1-(3-bromo-2-chloro-6-fluorophenyl)ethanone. InChIKey: XWOVEUPYIWFSHC-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2ClFO |
|---|---|
| Molecular weight | 330.37 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-2-chloro-6-fluorophenyl)ethanone |
| InChIKey | XWOVEUPYIWFSHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)CBr)Cl)Br |
Computed by PubChem (NCBI)