CAS 1807121-46-5 appears in our catalog under these names: 3-Bromo-6-chloro-2-fluorophenacyl bromide, 95%, 3-Bromo-6-chloro-2-fluorophenacyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-bromo-1-(3-bromo-6-chloro-2-fluorophenyl)ethanone (CAS 1807121-46-5) is a chemical compound with the molecular formula C8H4Br2ClFO and a molecular weight of 330.37 g/mol. IUPAC name: 2-bromo-1-(3-bromo-6-chloro-2-fluorophenyl)ethanone. InChIKey: VLRDFOBVZMPTTH-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2ClFO |
|---|---|
| Molecular weight | 330.37 g/mol |
| IUPAC name | 2-bromo-1-(3-bromo-6-chloro-2-fluorophenyl)ethanone |
| InChIKey | VLRDFOBVZMPTTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C(=O)CBr)F)Br |
Computed by PubChem (NCBI)